What is the IUPAC name of Chembrdg-bb 4003247?
The IUPAC name of Chembrdg-bb 4003247 is 5-cyclohexylthiophene-2-carbaldehyde.
What is the molecular formula of Chembrdg-bb 4003247?
The molecular formula of Chembrdg-bb 4003247 is C11H14OS.
What is the molecular weight of Chembrdg-bb 4003247?
The molecular weight of Chembrdg-bb 4003247 is 194.30 g/mol.
What is the InChI of Chembrdg-bb 4003247?
The InChI of Chembrdg-bb 4003247 is InChI=1S/C11H14OS/c12-8-10-6-7-11(13-10)9-4-2-1-3-5-9/h6-9H,1-5H2.
What is the InChIKey of Chembrdg-bb 4003247?
The InChIKey of Chembrdg-bb 4003247 is PKJNSTIWWCVZRG-UHFFFAOYSA-N.
What is the Canonical SMILES of Chembrdg-bb 4003247?
The Canonical SMILES of Chembrdg-bb 4003247 is C1CCC(CC1)C2=CC=C(S2)C=O.
What is the CAS number of Chembrdg-bb 4003247?
The CAS number of Chembrdg-bb 4003247 is 915919-68-5.
How many hydrogen bond acceptors does Chembrdg-bb 4003247 have?
Chembrdg-bb 4003247 has 2 hydrogen bond acceptors.
What is the topological polar surface area of Chembrdg-bb 4003247?
The topological polar surface area of Chembrdg-bb 4003247 is 45.3?2.
Is the compound canonicalized in PubChem?
Yes, the compound is canonicalized in PubChem.