What is the molecular formula of the Sfrp-1 inhibitor?
The molecular formula of the Sfrp-1 inhibitor is C19H26N2O4S2.
What is the molecular weight of the Sfrp-1 inhibitor?
The molecular weight of the Sfrp-1 inhibitor is 410.6 g/mol.
When was the Sfrp-1 inhibitor first created?
The Sfrp-1 inhibitor was first created on February 16, 2009.
What is the IUPAC name of the Sfrp-1 inhibitor?
The IUPAC name of the Sfrp-1 inhibitor is 5-(benzenesulfonyl)-N-[3-(dimethylamino)propyl]-2-ethylbenzenesulfonamide.
What is the InChIKey of the Sfrp-1 inhibitor?
The InChIKey of the Sfrp-1 inhibitor is BHFFSIFXFHJJNJ-UHFFFAOYSA-N.
What is the Canonical SMILES of the Sfrp-1 inhibitor?
The Canonical SMILES of the Sfrp-1 inhibitor is CCC1=C(C=C(C=C1)S(=O)(=O)C2=CC=CC=C2)S(=O)(=O)NCCCN(C)C.
What is the CAS number of the Sfrp-1 inhibitor?
The CAS number of the Sfrp-1 inhibitor is 915754-88-0.
What is the XLogP3-AA value of the Sfrp-1 inhibitor?
The XLogP3-AA value of the Sfrp-1 inhibitor is 2.9.
How many hydrogen bond donor counts does the Sfrp-1 inhibitor have?
The Sfrp-1 inhibitor has 1 hydrogen bond donor count.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Download
![3'-[n,N-Bis(2-ethylcarbonyloxyethyl)amino]-4'-methoxyacetanilide](https://resource.alfa-chemistry.com/structure/91576-34-0.gif)
