What is the molecular formula of Benzenemethanamine,4-(1-methyl-1H-pyrazol-3-yl)?
The molecular formula is C11H13N3.
When was Benzenemethanamine,4-(1-methyl-1H-pyrazol-3-yl) created and last modified?
It was created on 2008-02-29 and last modified on 2023-12-30.
What is the IUPAC name of Benzenemethanamine,4-(1-methyl-1H-pyrazol-3-yl)?
The IUPAC name is [4-(1-methylpyrazol-3-yl)phenyl]methanamine.
What is the InChI of Benzenemethanamine,4-(1-methyl-1H-pyrazol-3-yl)?
The InChI is InChI=1S/C11H13N3/c1-14-7-6-11(13-14)10-4-2-9(8-12)3-5-10/h2-7H,8,12H2,1H3.
What is the molecular weight of Benzenemethanamine,4-(1-methyl-1H-pyrazol-3-yl)?
The molecular weight is 187.24 g/mol.
What is the Canonical SMILES of Benzenemethanamine,4-(1-methyl-1H-pyrazol-3-yl)?
The Canonical SMILES is CN1C=CC(=N1)C2=CC=C(C=C2)CN.
How many hydrogen bond donor counts does Benzenemethanamine,4-(1-methyl-1H-pyrazol-3-yl) have?
It has 1 hydrogen bond donor count.
What is the XLogP3-AA value of Benzenemethanamine,4-(1-methyl-1H-pyrazol-3-yl)?
The XLogP3-AA value is 0.8.
What is the topological polar surface area of Benzenemethanamine,4-(1-methyl-1H-pyrazol-3-yl)?
The topological polar surface area is 43.8 Ų.
Is Benzenemethanamine,4-(1-methyl-1H-pyrazol-3-yl) a canonicalized compound?
Yes, it is a canonicalized compound.