What is the molecular formula of N-(2-Succinyl)phenylephrine?
The molecular formula of N-(2-Succinyl)phenylephrine is C13H17NO6.
What is the molecular weight of N-(2-Succinyl)phenylephrine?
The molecular weight of N-(2-Succinyl)phenylephrine is 283.28 g/mol.
When was N-(2-Succinyl)phenylephrine created?
N-(2-Succinyl)phenylephrine was created on November 1, 2013.
What is the IUPAC name of N-(2-Succinyl)phenylephrine?
The IUPAC name of N-(2-Succinyl)phenylephrine is 2-[[(2R)-2-hydroxy-2-(3-hydroxyphenyl)ethyl]-methylamino]butanedioic acid.
What is the InChI of N-(2-Succinyl)phenylephrine?
The InChI of N-(2-Succinyl)phenylephrine is InChI=1S/C13H17NO6/c1-14(10(13(19)20)6-12(17)18)7-11(16)8-3-2-4-9(15)5-8/h2-5,10-11,15-16H,6-7H2,1H3,(H,17,18)(H,19,20)/t10?,11-/m0/s1.
What is the InChIKey of N-(2-Succinyl)phenylephrine?
The InChIKey of N-(2-Succinyl)phenylephrine is NILXUFZCPICFBR-DTIOYNMSSA-N.
What are the synonyms of N-(2-Succinyl)phenylephrine?
The synonyms of N-(2-Succinyl)phenylephrine are 915278-80-7, 2-[[(2R)-2-hydroxy-2-(3-hydroxyphenyl)ethyl]-methylamino]butanedioic acid, N-(2-Succinyl)phenylephrine(mixture of diastereomers), N-(2-Succinyl) Phenylephrine(Mixture of Diastereomers) (>85%).
What is the XLogP3-AA value of N-(2-Succinyl)phenylephrine?
The XLogP3-AA value of N-(2-Succinyl)phenylephrine is -2.4.
How many hydrogen bond donor counts does N-(2-Succinyl)phenylephrine have?
N-(2-Succinyl)phenylephrine has 4 hydrogen bond donor counts.
How many rotatable bond counts does N-(2-Succinyl)phenylephrine have?
N-(2-Succinyl)phenylephrine has 7 rotatable bond counts.
※ Please kindly note that our products are for research use only.