What is the molecular formula of 2-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-ol?
The molecular formula is C12H9N3O.
What is the molecular weight of 2-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-ol?
The molecular weight is 211.22 g/mol.
What is the IUPAC name of 2-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-ol?
The IUPAC name is 2-phenyl-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one.
What is the InChI of 2-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-ol?
The InChI is InChI=1S/C12H9N3O/c16-12-9-6-7-13-11(9)14-10(15-12)8-4-2-1-3-5-8/h1-7H,(H2,13,14,15,16).
What is the InChIKey of 2-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-ol?
The InChIKey is FBCXXFFNKMCXBW-UHFFFAOYSA-N.
What is the Canonical SMILES of 2-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-ol?
The Canonical SMILES is C1=CC=C(C=C1)C2=NC3=C(C=CN3)C(=O)N2.
How many hydrogen bond donor counts does 2-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-ol have?
It has 2 hydrogen bond donor counts.
What is the XLogP3-AA value of 2-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-ol?
The XLogP3-AA value is 1.5.
What is the topological polar surface area of 2-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-ol?
The topological polar surface area is 57.2 Ų.
Is 2-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-ol canonicalized?
Yes, the compound is canonicalized.