What is the molecular formula of 4-Imidazolo-2-pyridinecarboxylic Acid?
The molecular formula is C9H7N3O2.
What are the synonyms of 4-Imidazolo-2-pyridinecarboxylic Acid?
The synonyms include 4-(1H-Imidazol-1-yl)pyridine-2-carboxylic acid, 4-imidazol-1-ylpyridine-2-carboxylic acid, and 4-(1H-imidazol-1-yl)picolinic acid.
What is the molecular weight of 4-Imidazolo-2-pyridinecarboxylic Acid?
The molecular weight is 189.17 g/mol.
What is the InChIKey of 4-Imidazolo-2-pyridinecarboxylic Acid?
The InChIKey is GFUFIDWOYDZIGB-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Imidazolo-2-pyridinecarboxylic Acid?
The canonical SMILES is C1=CN=C(C=C1N2C=CN=C2)C(=O)O.
What is the CAS number of 4-Imidazolo-2-pyridinecarboxylic Acid?
The CAS number is 914637-20-0.
What is the XLogP3-AA value of 4-Imidazolo-2-pyridinecarboxylic Acid?
The XLogP3-AA value is 0.5.
How many hydrogen bond donor counts does 4-Imidazolo-2-pyridinecarboxylic Acid have?
It has 1 hydrogen bond donor count.
What is the topological polar surface area of 4-Imidazolo-2-pyridinecarboxylic Acid?
The topological polar surface area is 68 Ų.
Is the compound canonicalized?
Yes, the compound is canonicalized.
※ Please kindly note that our products are for research use only.