What is the molecular formula of Benzenemethanol,2-(4-ethyl-1-piperazinyl)-?
The molecular formula is C13H20N2O.
What is the molecular weight of Benzenemethanol,2-(4-ethyl-1-piperazinyl)-?
The molecular weight is 220.31 g/mol.
What is the IUPAC Name of Benzenemethanol,2-(4-ethyl-1-piperazinyl)-?
The IUPAC Name is [2-(4-ethylpiperazin-1-yl)phenyl]methanol.
What is the InChI of Benzenemethanol,2-(4-ethyl-1-piperazinyl)-?
The InChI is InChI=1S/C13H20N2O/c1-2-14-7-9-15(10-8-14)13-6-4-3-5-12(13)11-16/h3-6,16H,2,7-11H2,1H3.
What is the InChIKey of Benzenemethanol,2-(4-ethyl-1-piperazinyl)-?
The InChIKey is KRYOTUHYCVJRAS-UHFFFAOYSA-N.
How many hydrogen bond donor counts does Benzenemethanol,2-(4-ethyl-1-piperazinyl)- have?
It has 1 hydrogen bond donor count.
What is the topological polar surface area of Benzenemethanol,2-(4-ethyl-1-piperazinyl)-?
The topological polar surface area is 26.7 Å2.
Is Benzenemethanol,2-(4-ethyl-1-piperazinyl)- a canonicalized compound?
Yes, it is a canonicalized compound.
What is the exact mass of Benzenemethanol,2-(4-ethyl-1-piperazinyl)-?
The exact mass is 220.157563266 g/mol.
How many rotatable bond counts does Benzenemethanol,2-(4-ethyl-1-piperazinyl)- have?
It has 3 rotatable bond counts.