What is the molecular formula of 2-Piperidin-1-ylmethylbenzoic acid methyl ester?
The molecular formula of 2-Piperidin-1-ylmethylbenzoic acid methyl ester is C14H19NO2.
What is the molecular weight of 2-Piperidin-1-ylmethylbenzoic acid methyl ester?
The molecular weight of 2-Piperidin-1-ylmethylbenzoic acid methyl ester is 233.31 g/mol.
What is the IUPAC name of 2-Piperidin-1-ylmethylbenzoic acid methyl ester?
The IUPAC name of 2-Piperidin-1-ylmethylbenzoic acid methyl ester is methyl 2-(piperidin-1-ylmethyl)benzoate.
What is the InChI of 2-Piperidin-1-ylmethylbenzoic acid methyl ester?
The InChI of 2-Piperidin-1-ylmethylbenzoic acid methyl ester is InChI=1S/C14H19NO2/c1-17-14(16)13-8-4-3-7-12(13)11-15-9-5-2-6-10-15/h3-4,7-8H,2,5-6,9-11H2,1H3.
How many hydrogen bond donor counts are there in 2- Piperidin-1-ylmethylbenzoic acid methyl ester?
There are 0 hydrogen bond donor counts in 2- Piperidin-1-ylmethylbenzoic acid methyl ester.
What is the topological polar surface area of 2-Piperidin-1-ylmethylbenzoic acid methyl ester?
The topological polar surface area of 2-Piperidin-1-ylmethylbenzoic acid methyl ester is 29.5 Ų.
Is 2-Piperidin-1-ylmethylbenzoic acid methyl ester a canonicalized compound?
Yes, 2-Piperidin-1-ylmethylbenzoic acid methyl ester is a canonicalized compound.
What is the formal charge of 2-Piperidin-1-ylmethylbenzoic acid methyl ester?
The formal charge of 2-Piperidin-1-ylmethylbenzoic acid methyl ester is 0.
How many rotatable bond counts are there in 2-Piperidin-1-ylmethylbenzoic acid methyl ester?
There are 4 rotatable bond counts in 2-Piperidin-1-ylmethylbenzoic acid methyl ester.
What is the Isotope Atom Count of 2-Piperidin-1-ylmethylbenzoic acid methyl ester?
The Isotope Atom Count of 2-Piperidin-1-ylmethylbenzoic acid methyl ester is 0.
※ Please kindly note that our products are for research use only.