What is the molecular formula of 2(1H)-Quinolinone,7-(4-chlorobutoxy)?
The molecular formula is C13H14ClNO2.
What is the molecular weight of 2(1H)-Quinolinone,7-(4-chlorobutoxy)?
The molecular weight is 251.71 g/mol.
What is the IUPAC name of 2(1H)-Quinolinone,7-(4-chlorobutoxy)?
The IUPAC name is 7-(4-chlorobutoxy)-4aH-quinolin-2-one.
What is the InChI of 2(1H)-Quinolinone,7-(4-chlorobutoxy)?
The InChI is InChI=1S/C13H14ClNO2/c14-7-1-2-8-17-11-5-3-10-4-6-13(16)15-12(10)9-11/h3-6,9-10H,1-2,7-8H2.
What is the InChIKey of 2(1H)-Quinolinone,7-(4-chlorobutoxy)?
The InChIKey is RFQNTSDVDCKDKP-UHFFFAOYSA-N.
What is the canonical SMILES of 2(1H)-Quinolinone,7-(4-chlorobutoxy)?
The canonical SMILES is C1=CC(=CC2=NC(=O)C=CC21)OCCCCCl.
What is the XLogP3-AA value of 2(1H)-Quinolinone,7-(4-chlorobutoxy)?
The XLogP3-AA value is 2.2.
How many hydrogen bond donor counts are there in 2(1H)-Quinolinone,7-(4-chlorobutoxy)?
There are 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts are there in 2(1H)-Quinolinone,7-(4-chlorobutoxy)?
There are 2 hydrogen bond acceptor counts.
How many rotatable bond counts are there in 2(1H)-Quinolinone,7-(4-chlorobutoxy)?
There are 5 rotatable bond counts.