What is the molecular formula of 2-Pyrimidinamine,4-(3-bromophenyl)-6-methyl?
The molecular formula is C11H10BrN3.
What is the weight of 2-Pyrimidinamine,4-(3-bromophenyl)-6-methyl?
The molecular weight is 264.12 g/mol.
What is the IUPAC name of 2-Pyrimidinamine,4-(3-bromophenyl)-6-methyl?
The IUPAC name is 4-(3-bromophenyl)-6-methylpyrimidin-2-amine.
What is the InChI of 2-Pyrimidinamine,4-(3-bromophenyl)-6-methyl?
The InChI is InChI=1S/C11H10BrN3/c1-7-5-10(15-11(13)14-7)8-3-2-4-9(12)6-8/h2-6H,1H3,(H2,13,14,15).
What is the InChIKey of 2-Pyrimidinamine,4-(3-bromophenyl)-6-methyl?
The InChIKey is CEAPNKQDFOFIPD-UHFFFAOYSA-N.
What is the Canonical SMILES of 2-Pyrimidinamine,4-(3-bromophenyl)-6-methyl?
The Canonical SMILES is CC1=CC(=NC(=N1)N)C2=CC(=CC=C2)Br.
What is the CAS number of 2-Pyrimidinamine,4-(3-bromophenyl)-6-methyl?
The CAS number is 913322-49-3.
What is the molecular weight of 2-Pyrimidinamine,4-(3-bromophenyl)-6-methyl?
The molecular weight is 264.12 g/mol.
How many hydrogen bond donor counts does 2-Pyrimidinamine,4-(3-bromophenyl)-6-methyl have?
It has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 2-Pyrimidinamine,4-(3-bromophenyl)-6-methyl have?
It has 3 hydrogen bond acceptor counts.