What is the PubChem CID of Difluoxacin HCl?
The PubChem CID of Difluoxacin HCl is 56205.
What is the molecular formula of Difluoxacin HCl?
The molecular formula of Difluoxacin HCl is C21H20ClF2N3O3.
What is the molecular weight of Difluoxacin HCl?
The molecular weight of Difluoxacin HCl is 435.8 g/mol.
What is the IUPAC name of Difluoxacin HCl?
The IUPAC name of Difluoxacin HCl is 6-fluoro-1-(4-fluorophenyl)-7-(4-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid;hydrochloride.
What is the InChI of Difluoxacin HCl?
The InChI of Difluoxacin HCl is InChI=1S/C21H19F2N3O3.ClH/c1-24-6-8-25(9-7-24)19-11-18-15(10-17(19)23)20(27)16(21(28)29)12-26(18)14-4-2-13(22)3-5-14;/h2-5,10-12H,6-9H2,1H3,(H,28,29);1H.
What is the InChIKey of Difluoxacin HCl?
The InChIKey of Difluoxacin HCl is JFMGBGLSDVIOHL-UHFFFAOYSA-N.
What is the canonical SMILES of Difluoxacin HCl?
The canonical SMILES of Difluoxacin HCl is CN1CCN(CC1)C2=C(C=C3C(=C2)N(C=C(C3=O)C(=O)O)C4=CC=C(C=C4)F)F.Cl.
What is the CAS number of Difluoxacin HCl?
The CAS number of Difluoxacin HCl is 91296-86-5.
What is the ChEMBL ID of Difluoxacin HCl?
The ChEMBL ID of Difluoxacin HCl is CHEMBL542414.