What is the molecular formula of Alpha, 1-dimethyl-1H-pyrazole-5-methanamine?
The molecular formula is C6H11N3.
What is the molecular weight of Alpha, 1-dimethyl-1H-pyrazole-5-methanamine?
The molecular weight is 125.17 g/mol.
What are some synonyms for Alpha, 1-dimethyl-1H-pyrazole-5-methanamine?
Some synonyms include 911788-37-9, 1-(2-Methyl-2H-pyrazol-3-yl)-ethylamine, and 1-(1-Methyl-1H-pyrazol-5-yl)ethan-1-amine.
When was Alpha, 1-dimethyl-1H-pyrazole-5-methanamine first created on PubChem?
It was first created on December 5, 2007.
What is the InChI of Alpha, 1-dimethyl-1H-pyrazole-5-methanamine?
The InChI is InChI=1S/C6H11N3/c1-5(7)6-3-4-8-9(6)2/h3-5H,7H2,1-2H3.
How many hydrogen bond acceptors are there in Alpha, 1-dimethyl-1H-pyrazole-5-methanamine?
There are 2 hydrogen bond acceptors.
What is the topological polar surface area of Alpha, 1-dimethyl-1H-pyrazole-5-methanamine?
The topological polar surface area is 43.8 Ų.
Is the compound canonicalized in PubChem?
Yes, the compound is canonicalized in PubChem.
What is the formal charge of Alpha, 1-dimethyl-1H-pyrazole-5-methanamine?
The formal charge is 0.
How many covalently-bonded units are there in Alpha, 1-dimethyl-1H-pyrazole-5-methanamine?
There is 1 covalently-bonded unit.