What is the molecular formula of Akos BBS-00008199?
The molecular formula of Akos BBS-00008199 is C14H15NO4.
What are the synonyms of Akos BBS-00008199?
The synonyms of Akos BBS-00008199 are 91153-72-9, 7-hydroxy-N-(2-methylpropyl)-2-oxo-2H-chromene-3-carboxamide, 7-Hydroxy-N-isobutyl-2-oxo-2H-chromene-3-carboxamide, and 7-hydroxy-N-(2-methylpropyl)-2-oxochromene-3-carboxamide.
What is the molecular weight of Akos BBS-00008199?
The molecular weight of Akos BBS-00008199 is 261.27 g/mol.
What is the IUPAC name of Akos BBS-00008199?
The IUPAC name of Akos BBS-00008199 is 7-hydroxy-N-(2-methylpropyl)-2-oxochromene-3-carboxamide.
What is the InChI of Akos BBS-00008199?
The InChI of Akos BBS-00008199 is InChI=1S/C14H15NO4/c1-8(2)7-15-13(17)11-5-9-3-4-10(16)6-12(9)19-14(11)18/h3-6,8,16H,7H2,1-2H3,(H,15,17).
What is the InChIKey of Akos BBS-00008199?
The InChIKey of Akos BBS-00008199 is RAMNBEPDIMFXDJ-UHFFFAOYSA-N.
What is the canonical SMILES of Akos BBS-00008199?
The canonical SMILES of Akos BBS-00008199 is CC(C)CNC(=O)C1=CC2=C(C=C(C=C2)O)OC1=O.
What is the XLogP3-AA value of Akos BBS-00008199?
The XLogP3-AA value of Akos BBS-00008199 is 2.9.
How many hydrogen bond donor counts does Akos BBS-00008199 have?
Akos BBS-00008199 has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Akos BBS-00008199 have?
Akos BBS-00008199 has 4 hydrogen bond acceptor counts.