What is the molecular formula of methyl 1-oxo-1,2-dihydroisoquinoline-5-carboxylate?
The molecular formula is C11H9NO3.
When was methyl 1-oxo-1,2-dihydroisoquinoline-5-carboxylate created in PubChem?
It was created on June 17, 2009.
What is the IUPAC name of methyl 1-oxo-1,2-dihydroisoquinoline-5-carboxylate?
The IUPAC name is methyl 1-oxo-2H-isoquinoline-5-carboxylate.
What is the InChI of methyl 1-oxo-1,2-dihydroisoquinoline-5-carboxylate?
The InChI is InChI=1S/C11H9NO3/c1-15-11(14)9-4-2-3-8-7(9)5-6-12-10(8)13/h2-6H,1H3,(H,12,13).
What is the molecular weight of methyl 1-oxo-1,2-dihydroisoquinoline-5-carboxylate?
The molecular weight is 203.19 g/mol.
How many hydrogen bond donor counts does methyl 1-oxo-1,2-dihydroisoquinoline-5-carboxylate have?
It has 1 hydrogen bond donor count.
What is the XLogP3-AA value of methyl 1-oxo-1,2-dihydroisoquinoline-5-carboxylate?
The XLogP3-AA value is 1.2.
What is the topological polar surface area of methyl 1-oxo-1,2-dihydroisoquinoline-5-carboxylate?
The topological polar surface area is 55.4 Ų.
Does methyl 1-oxo-1,2-dihydroisoquinoline-5-carboxylate have any defined atom stereocenter counts?
No, it has 0 defined atom stereocenter counts.
Is methyl 1-oxo-1,2-dihydroisoquinoline-5-carboxylate a canonicalized compound in PubChem?
Yes, it is a canonicalized compound.