What is the molecular formula of toluene-2,6-diisocyanate?
The molecular formula of toluene-2,6-diisocyanate is C9H6N2O2.
What is the molecular weight of toluene-2,6-diisocyanate?
The molecular weight of toluene-2,6-diisocyanate is 174.16 g/mol.
What are the synonyms of toluene-2,6-diisocyanate?
The synonyms of toluene-2,6-diisocyanate include 2,6-Diisocyanatotoluene, Toluene-2,6-diisocyanate, 1,3-Diisocyanato-2-methylbenzene, and 2,6-TDI.
What is the IUPAC name of toluene-2,6-diisocyanate?
The IUPAC name of toluene-2,6-diisocyanate is 1,3-diisocyanato-2-methylbenzene.
What is the InChI of toluene-2,6-diisocyanate?
The InChI of toluene-2,6-diisocyanate is InChI=1S/C9H6N2O2/c1-7-8(10-5-12)3-2-4-9(7)11-6-13/h2-4H,1H3.
What is the InChIKey of toluene-2,6-diisocyanate?
The InChIKey of toluene-2,6-diisocyanate is RUELTTOHQODFPA-UHFFFAOYSA-N.
What is the canonical SMILES of toluene-2,6-diisocyanate?
The canonical SMILES of toluene-2,6-diisocyanate is CC1=C(C=CC=C1N=C=O)N=C=O.
What is the CAS number of toluene-2,6-diisocyanate?
The CAS number of toluene-2,6-diisocyanate is 91-08-7.
What is the UN number of toluene-2,6-diisocyanate?
The UN number of toluene-2,6-diisocyanate is 2078.
What is the hydroghttps://pubchem.ncbi.nlm.nih.gov/compound/7040en bond acceptor count of toluene-2,6-diisocyanate?
The hydrogwww.genome.jp/>Hydrogen atom bond acceptor count of toluene-2,6-diisocyanate is 4.