What is the molecular formula of 2,3-Dimethoxybenzylamine?
The molecular formula of 2,3-Dimethoxybenzylamine is C9H13NO2.
What is the molecular weight of 2,3-Dimethoxybenzylamine?
The molecular weight of 2,3-Dimethoxybenzylamine is 167.20 g/mol.
What is the IUPAC name of 2,3-Dimethoxybenzylamine?
The IUPAC name of 2,3-Dimethoxybenzylamine is (2,3-dimethoxyphenyl)methanamine.
What is the InChI of 2,3-Dimethoxybenzylamine?
The InChI of 2,3-Dimethoxybenzylamine is InChI=1S/C9H13NO2/c1-11-8-5-3-4-7(6-10)9(8)12-2/h3-5H,6,10H2,1-2H3.
What is the InChIKey of 2,3-Dimethoxybenzylamine?
The InChIKey of 2,3-Dimethoxybenzylamine is LVMPWFJVYMXSNY-UHFFFAOYSA-N.
What is the canonical SMILES of 2,3-Dimethoxybenzylamine?
The canonical SMILES of 2,3-Dimethoxybenzylamine is COC1=CC=CC(=C1OC)CN.
What is the CAS number of 2,3-Dimethoxybenzylamine?
The CAS number of 2,3-Dimethoxybenzylamine is 4393-09-3.
What is the European Community (EC) number of 2,3-Dimethoxybenzylamine?
The European Community (EC) number of 2,3-Dimethoxybenzylamine is 224-515-7.
What is the UNII of 2,3-Dimethoxybenzylamine?
The UNII of 2,3-Dimethoxybenzylamine is YC8UH2CND7.
What is the ChEMBL ID of 2,3-Dimethoxybenzylamine?
The ChEMBL ID of 2,3-Dimethoxybenzylamine is CHEMBL555371.