The molecular formula of the compound is C10H17N3.
What are the synonyms of the compound?
The synonyms of the compound are 6-METHYL-4-(PENTAN-3-YL)PYRIDAZIN-3-AMINE, 910552-61-3, 6-methyl-4-pentan-3-ylpyridazin-3-amine, and 4-(1-Ethyl-propyl)-6-methyl-pyridazin-3-ylamine.
What is the molecular weight of the compound?
The molecular weight of the compound is 179.26 g/mol.
When was the compound created and modified?
The compound was created on October 30, 2011, and last modified on December 30, 2023.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 6-methyl-4-pentan-3-ylpyridazin-3-amine.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C10H17N3/c1-4-8(5-2)9-6-7(3)12-13-10(9)11/h6,8H,4-5H2,1-3H3,(H2,11,13).
What is the InChIKey of the compound?
The InChIKey of the compound is GEEUQWPIJTZAQY-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CCC(CC)C1=C(N=NC(=C1)C)N.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 2.1.
How many hydrogen bond donor and acceptor counts does the compound have?
The compound has 1 hydrogen bond donor count and 3 hydrogen bond acceptor count.
※ Please kindly note that our products are for research use only.