What is the molecular formula of 5-Hydroxy-N-methyl-7H-dibenzo(c,g)carbazole?
The molecular formula is C21H15NO.
When was 5-Hydroxy-N-methyl-7H-dibenzo(c,g)carbazole created in PubChem?
It was created on August 8, 2005.
What is the molecular weight of 5-Hydroxy-N-methyl-7H-dibenzo(c,g)carbazole?
The molecular weight is 297.3 g/mol.
What is the IUPAC name of 5-Hydroxy-N-methyl-7H-dibenzo(c,g)carbazole?
The IUPAC name is 12-methyl-12-azapentacyclo[11.8.0.0 2,11 .0 3,8 .0 16,21 ]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaen-9-ol.
What is the Canonical SMILES representation of 5-Hydroxy-N-methyl-7H-dibenzo(c,g)carbazole?
The Canonical SMILES is CN1C2=C(C3=CC=CC=C3C=C2)C4=C1C=C(C5=CC=CC=C54)O.
What is the InChIKey of 5-Hydroxy-N-methyl-7H-dibenzo(c,g)carbazole?
The InChIKey is GLCFQTIVXGLNGF-UHFFFAOYSA-N.
How many hydrogen bond donor counts does 5-Hydroxy-N-methyl-7H-dibenzo(c,g)carbazole have?
It has a hydrogen bond donor count of 1.
What is the XLogP3-AA value of 5-Hydroxy-N-methyl-7H-dibenzo(c,g)carbazole?
The XLogP3-AA value is 5.5.
How many rotatable bond counts does 5-Hydroxy-N-methyl-7H-dibenzo(c,g)carbazole have?
It has 0 rotatable bond counts.
Is 5-Hydroxy-N-methyl-7H-dibenzo(c,g)carbazole a canonicalized compound according to PubChem?
Yes, it is a canonicalized compound.