Azoic coupling component 3

Name: Azoic coupling component 3
SKU: ACM91929
Rating: 5 (1 reviews)

CAS

91-92-9

Catalog Number

ACM91929

Category

Other Products

Molecular Weight

584.61732

Molecular Formula

C₃₆H₂₈N₂O₆

If you have any other questions or need other size, please get a quote.

Specification

Synonyms

Azoic Coupling Component 3;Naphthol AS-BR

What is the molecular formula of Azoic Coupling Component 3?

The molecular formula of Azoic Coupling Component 3 is C36H28N2O6.

What is the molecular weight of Azoic Coupling Component 3?

The molecular weight of Azoic Coupling Component 3 is 584.6 g/mol.

What is the IUPAC name of Azoic Coupling Component 3?

The IUPAC name of Azoic Coupling Component 3 is 3-hydroxy-N-[4-[4-[(3-hydroxynaphthalene-2-carbonyl)amino]-3-methoxyphenyl]-2-methoxyphenyl]naphthalene-2-carboxamide.

What is the InChI of Azoic Coupling Component 3?

The InChI of Azoic Coupling Component 3 is InChI=1S/C36H28N2O6/c1-43-33-19-25(11-13-29(33)37-35(41)27-15-21-7-3-5-9-23(21)17-31(27)39)26-12-14-30(34(20-26)44-2)38-36(42)28-16-22-8-4-6-10-24(22)18-32(28)40/h3-20,39-40H,1-2H3,(H,37,41)(H,38,42).

What is the InChIKey of Azoic Coupling Component 3?

The InChIKey of Azoic Coupling Component 3 is AXUHYNGMYQMRRI-UHFFFAOYSA-N.

What is the canonical SMILES of Azoic Coupling Component 3?

The canonical SMILES of Azoic Coupling Component 3 is COC1=C(C=CC(=C1)C2=CC(=C(C=C2)NC(=O)C3=CC4=CC=CC=C4C=C3O)OC)NC(=O)C5=CC6=CC=CC=C6C=C5O.

What is the CAS number of Azoic Coupling Component 3?

The CAS number of Azoic Coupling Component 3 is 91-92-9.

What is the XLogP3-AA value of Azoic Coupling Component 3?

The XLogP3-AA value of Azoic Coupling Component 3 is 8.1.

How many hydrogen bond donor counts are there in Azoic Coupling Component 3?

There are 4 hydrogen bond donor counts in Azoic Coupling Component 3.

How many rotatable bond counts are there in Azoic Coupling Component 3?

There are 7 rotatable bond counts in Azoic Coupling Component 3.