What is the molecular formula of 2-Chloronaphthalene?
The molecular formula of 2-Chloronaphthalene is C10H7Cl.
What is the molecular weight of 2-Chloronaphthalene?
The molecular weight of 2-Chloronaphthalene is 162.61 g/mol.
What is the IUPAC name of 2-Chloronaphthalene?
The IUPAC name of 2-Chloronaphthalene is 2-chloronaphthalene.
What is the InChI of 2-Chloronaphthalene?
The InChI of 2-Chloronaphthalene is InChI=1S/C10H7Cl/c11-10-6-5-8-3-1-2-4-9(8)7-10/h1-7H.
What is the InChIKey of 2-Chloronaphthalene?
The InChIKey of 2-Chloronaphthalene is CGYGETOMCSJHJU-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Chloronaphthalene?
The canonical SMILES of 2-Chloronaphthalene is C1=CC=C2C=C(C=CC2=C1)Cl.
What is the CAS number of 2-Chloronaphthalene?
The CAS number of 2-Chloronaphthalene is 91-58-7.
What is the UNII of 2-Chloronaphthalene?
The UNII of 2-Chloronaphthalene is 49O81U3ITI.
What is the ChEMBL ID of 2-Chloronaphthalene?
The ChEMBL ID of 2-Chloronaphthalene is CHEMBL372646.
What is the XLogP3 of 2-Chloronaphthalene?
The XLogP3 of 2-Chloronaphthalene is 4.1.