CAS
909532-61-2 Purity
96%
909532-61-2 Purity
96%
Shopping basket
2-Chloro-4-fluoro-1-methoxy-3-(trimethylsilyl)benzene
CAS
909543-27-7
Catalog Number
ACM909543277
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C10H14ClFOSi.
What is the molecular weight of the compound?
The molecular weight of the compound is 232.75 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is (2-chloro-6-fluoro-3-methoxyphenyl)-trimethylsilane.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C10H14ClFOSi/c1-13-8-6-5-7(12)10(9(8)11)14(2,3)4/h5-6H,1-4H3.
What is the InChIKey of the compound?
The InChIKey of the compound is YVQZKTRPUMDUFQ-UHFFFAOYSA-N.
What is the canonical SMILES representation of the compound?
The canonical SMILES representation of the compound is COC1=C(C(=C(C=C1)F)[Si](C)(C)C)Cl.
What is the hydrogen bond donor count of the compound?
The compound has 0 hydrogen bond donor count.
What is the hydrogen bond acceptor count of the compound?
The compound has 2 hydrogen bond acceptor count.
How many rotatable bonds are present in the compound?
The compound has 2 rotatable bonds.
What is the topological polar surface area of the compound?
The compound has a topological polar surface area of 9.2 Ų.
Recommended Products
![2-[(furan-2-ylmethyl)sulfanyl]propanoate](https://resource.alfa-chemistry.com/structure/90953-98-3.gif)
