What is the molecular formula of the compound Benzoic acid, 4-(1-methylethoxy)-,hydrazide?
The molecular formula is C10H14N2O2.
What is the molecular weight of Benzoic acid, 4-(1-methylethoxy)-,hydrazide?
The molecular weight is 194.23 g/mol.
What is the IUPAC name of Benzoic acid, 4-(1-methylethoxy)-,hydrazide?
The IUPAC name is 4-propan-2-yloxybenzohydrazide.
What is the InChI of Benzoic acid, 4-(1-methylethoxy)-,hydrazide?
The InChI is InChI=1S/C10H14N2O2/c1-7(2)14-9-5-3-8(4-6-9)10(13)12-11/h3-7H,11H2,1-2H3,(H,12,13).
What is the InChIKey of Benzoic acid, 4-(1-methylethoxy)-,hydrazide?
The InChIKey is BMHIKEZRFTUXGI-UHFFFAOYSA-N.
How many hydrogen bond donor counts does Benzoic acid, 4-(1-methylethoxy)-,hydrazide have?
It has 2 hydrogen bond donor counts.
What is the exact mass of Benzoic acid, 4-(1-methylethoxy)-,hydrazide?
The exact mass is 194.105527694 g/mol.
What is the topological polar surface area of Benzoic acid, 4-(1-methylethoxy)-,hydrazide?
The topological polar surface area is 64.4?2.
How many heavy atoms are present in the compound Benzoic acid, 4-(1-methylethoxy)-,hydrazide?
There are 14 heavy atoms present.
Is the compound Benzoic acid, 4-(1-methylethoxy)-,hydrazide canonicalized?
Yes, the compound is canonicalized.