What is the molecular formula of Chembrdg-bb 4012405?
The molecular formula of Chembrdg-bb 4012405 is C10H12N4S.
What is the synonym for Chembrdg-bb 4012405?
One of the synonyms for Chembrdg-bb 4012405 is 4-Isopropyl-5-(pyridin-4-yl)-4H-1,2,4-triazole-3-thiol.
What is the molecular weight of Chembrdg-bb 4012405?
The molecular weight of Chembrdg-bb 4012405 is 220.30 g/mol.
When was Chembrdg-bb 4012405 created?
Chembrdg-bb 4012405 was created on July 9, 2005.
What is the IUPAC name of Chembrdg-bb 4012405?
The IUPAC name of Chembrdg-bb 4012405 is 4-propan-2-yl-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione.
What is the InChIKey of Chembrdg-bb 4012405?
The InChIKey of Chembrdg-bb 4012405 is JCEBCTLZJBGPKG-UHFFFAOYSA-N.
What is the Canonical SMILES of Chembrdg-bb 4012405?
The Canonical SMILES of Chembrdg-bb 4012405 is CC(C)N1C(=NNC1=S)C2=CC=NC=C2.
What is the CAS number of Chembrdg-bb 4012405?
The CAS number of Chembrdg-bb 4012405 is 90871-43-5.
What is the ChEMBL ID of Chembrdg-bb 4012405?
The ChEMBL ID of Chembrdg-bb 4012405 is CHEMBL1456574.
What is the XLogP3-AA value of Chembrdg-bb 4012405?
The XLogP3-AA value of Chembrdg-bb 4012405 is 1.4.