908333-99-3 Purity
---
If you have any other questions or need other size, please get a quote.
The molecular formula of the compound is C12H13BrO2.
The synonyms for the compound are 908334-02-1, 4-Bromo-7-methyl-1,1-(ethylenedioxo)-indane, DTXSID40669791, and 4'-Bromo-7'-methyl-2',3'-dihydrospiro[1,3-dioxolane-2,1'-indene].
The molecular weight of the compound is 269.13 g/mol.
The IUPAC name of the compound is 7-bromo-4-methylspiro[1,2-dihydroindene-3,2'-1,3-dioxolane].
The InChI of the compound is InChI=1S/C12H13BrO2/c1-8-2-3-10(13)9-4-5-12(11(8)9)14-6-7-15-12/h2-3H,4-7H2,1H3.
The InChIKey of the compound is ZMSHXGCHJNAZTJ-UHFFFAOYSA-N.
The canonical SMILES of the compound is CC1=C2C(=C(C=C1)Br)CCC23OCCO3.
The XLogP3-AA value of the compound is 2.6.
The compound has 0 hydrogen bond donor counts.
The compound has 2 hydrogen bond acceptor counts.
Download
×