What is the molecular formula of 1,3,4,6,6,7,8,9-Octahydro-cyclooctaimidazol-2-one?
The molecular formula is C9H14N2O.
What are some synonyms for 1,3,4,6,6,7,8,9-Octahydro-cyclooctaimidazol-2-one?
Some synonyms include 908334-00-9, DTXSID10669627, and AKOS006290542.
What is the molecular weight of 1,3,4,5,6,7,8,9-Octahydro-cyclooctaimidazol-2-one?
The molecular weight is 166.22 g/mol.
What is the IUPAC name of 1,3,4,5,6,7,8,9-Octahydro-cyclooctaimidazol-2-one?
The IUPAC name is 1,3,4,5,6,7,8,9-octahydrocycloocta[d]imidazol-2-one.
What is the InChI of 1,3,4,5,6,7,8,9-Octahydro-cyclooctaimidazol-2-one?
The InChI is InChI=1S/C9H14N2O/c12-9-10-7-5-3-1-2-4-6-8(7)11-9/h1-6H2,(H2,10,11,12).
What is the InChIKey of 1,3,4,5,6,7,8,9-Octahydro-cyclooctaimidazol-2-one?
The InChIKey is AFIVNQSXCWSYSH-UHFFFAOYSA-N.
What is the canonical SMILES of 1,3,4,5,6,7,8,9-Octahydro-cyclooctaimidazol-2-one?
The canonical SMILES is C1CCCC2=C(CC1)NC(=O)N2.
What is the XLogP3-AA value of 1,3,4,5,6,7,8,9-Octahydro-cyclooctaimidazol-2-one?
The XLogP3-AA value is 1.3.
How many hydrogen bond donor counts does 1,3,4,5,6,7,8,9-Octahydro-cyclooctaimidazol-2-one have?
It has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 1,3,4,5,6,7,8,9-Octahydro-cyclooctaimidazol-2-one have?
It has 1 hydrogen bond acceptor count.