What is the molecular formula of 3-Iodo-5-nitroindole?
The molecular formula of 3-Iodo-5-nitroindole is C8H5IN2O2.
When was 3-Iodo-5-nitroindole created in PubChem?
3-Iodo-5-nitroindole was created in PubChem on December 5, 2007.
What is the IUPAC name of 3-Iodo-5-nitroindole?
The IUPAC name of 3-Iodo-5-nitroindole is 3-iodo-5-nitro-1H-indole.
What is the InChIKey of 3-Iodo-5-nitroindole?
The InChIKey of 3-Iodo-5-nitroindole is YRJOAOLHLHTRDC-UHFFFAOYSA-N.
What is the Canonical SMILES of 3-Iodo-5-nitroindole?
The Canonical SMILES of 3-Iodo-5-nitroindole is C1=CC2=C(C=C1[N+](=O)[O-])C(=CN2)I.
What is the CAS number of 3-Iodo-5-nitroindole?
The CAS number of 3-Iodo-5-nitroindole is 908295-26-1.
What is the molecular weight of 3-Iodo-5-nitroindole?
The molecular weight of 3-Iodo-5-nitroindole is 288.04 g/mol.
How many hydrogen bond donor counts does 3-Iodo-5-nitroindole have?
3-Iodo-5-nitroindole has 1 hydrogen bond donor count.
What is the topological polar surface area of 3-Iodo-5-nitroindole?
The topological polar surface area of 3-Iodo-5-nitroindole is 61.6 Ų.
Is 3-Iodo-5-nitroindole a canonicalized compound?
Yes, 3-Iodo-5-nitroindole is a canonicalized compound in PubChem.