What is the molecular formula of Hexacosatetraenoic acid?
The molecular formula of Hexacosatetraenoic acid is C26H44O2.
What is the molecular weight of Hexacosatetraenoic acid?
The molecular weight of Hexacosatetraenoic acid is 388.6 g/mol.
What is the IUPAC name of Hexacosatetraenoic acid?
The IUPAC name of Hexacosatetraenoic acid is (2E,4E,6E,8E)-hexacosa-2,4,6,8-tetraenoic acid.
What is the InChI of Hexacosatetraenoic acid?
The InChI of Hexacosatetraenoic acid is InChI=1S/C26H44O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26(27)28/h18-25H,2-17H2,1H3,(H,27,28)/b19-18+,21-20+,23-22+,25-24+.
What is the InChIKey of Hexacosatetraenoic acid?
The InChIKey of Hexacosatetraenoic acid is MHWUJHJVQVPKHD-KVKDIOEXSA-N.
What is the canonical SMILES of Hexacosatetraenoic acid?
The canonical SMILES of Hexacosatetraenoic acid is CCCCCCCCCCCCCCCCC=CC=CC=CC=CC(=O)O.
What is the isomeric SMILES of Hexacosatetraenoic acid?
The isomeric SMILES of Hexacosatetraenoic acid is CCCCCCCCCCCCCCCCC/C=C/C=C/C=C/C=C/C(=O)O.
What is the CAS number of Hexacosatetraenoic acid?
The CAS number of Hexacosatetraenoic acid is 90829-84-8.
What is the XLogP3-AA value of Hexacosatetraenoic acid?
The XLogP3-AA value of Hexacosatetraenoic acid is 11.1.
Is Hexacosatetraenoic acid canonicalized as a compound?
Yes, Hexacosatetraenoic acid is canonicalized as a compound.