What is the molecular formula of Tropine-3-thiol HCl?
The molecular formula of Tropine-3-thiol HCl is C8H16ClNS.
What is the molecular weight of Tropine-3-thiol HCl?
The molecular weight of Tropine-3-thiol HCl is 193.74 g/mol.
What is the IUPAC name of Tropine-3-thiol HCl?
The IUPAC name of Tropine-3-thiol HCl is (1S,5R)-8-methyl-8-azabicyclo[3.2.1]octane-3-thiol;hydrochloride.
What is the InChI of Tropine-3-thiol HCl?
The InChI of Tropine-3-thiol HCl is InChI=1S/C8H15NS.ClH/c1-9-6-2-3-7(9)5-8(10)4-6;/h6-8,10H,2-5H2,1H3;1H/t6-,7+,8?.
What is the InChIKey of Tropine-3-thiol HCl?
The InChIKey of Tropine-3-thiol HCl is IOTZTIZFEAOBRO-PAFGHYSMSA-N.
What is the canonical SMILES of Tropine-3-thiol HCl?
The canonical SMILES of Tropine-3-thiol HCl is CN1C2CCC1CC(C2)S.Cl.
What is the European Community (EC) number of Tropine-3-thiol HCl?
The European Community (EC) number of Tropine-3-thiol HCl is 928-029-2.
What is the hydrogen bond donor count of Tropine-3-thiol HCl?
The hydrogen bond donor count of Tropine-3-thiol HCl is 2.
What is the hydrogen bond acceptor count of Tropine-3-thiol HCl?
The hydrogen bond acceptor count of Tropine-3-thiol HCl is 2.
Is Tropine-3-thiol HCl a canonicalized compound?
Yes, Tropine-3-thiol HCl is a canonicalized compound.