The molecular formula of the compound is C16H11Cl2NO.
What are the synonyms of the compound?
The synonyms of the compound are 1-(3,4-dichlorobenzyl)-1H-indole-3-carbaldehyde, 90815-02-4, 1-[(3,4-dichlorophenyl)methyl]indole-3-carbaldehyde, and CBMicro_006631.
What is the molecular weight of the compound?
The molecular weight of the compound is 304.2 g/mol.
When was the compound created?
The compound was created on July 9, 2005.
When was the compound last modified?
The compound was last modified on December 30, 2023.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 1-[(3,4-dichlorophenyl)methyl]indole-3-carbaldehyde.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C16H11Cl2NO/c17-14-6-5-11(7-15(14)18)8-19-9-12(10-20)13-3-1-2-4-16(13)19/h1-7,9-10H,8H2.
What is the InChIKey of the compound?
The InChIKey of the compound is PQXZTOVCTWAOJL-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C1=CC=C2C(=C1)C(=CN2CC3=CC(=C(C=C3)Cl)Cl)C=O.
How many hydrogen bond acceptors does the compound have?
The compound has 1 hydrogen bond acceptor.
※ Please kindly note that our products are for research use only.