908103-37-7 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C21H25ClN2O4.
The molecular weight of the compound is 404.9 g/mol.
The IUPAC name of the compound is 2-[4-aminobutyl(9H-fluoren-9-ylmethoxycarbonyl)amino]acetic acid; hydrochloride.
The InChI key of the compound is MBHKMMQEFPEQOO-UHFFFAOYSA-N.
The canonical SMILES notation of the compound is C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N(CCCCN)CC(=O)O.Cl.
The hydrogen bond donor count of the compound is 3.
The hydrogen bond acceptor count of the compound is 5.
The rotatable bond count of the compound is 9.
The topological polar surface area of the compound is 92.9?2.
There are 28 heavy atoms present in the compound.