What is the molecular formula of Benzimidazole, 1-(dichloroacetyl)-2-methyl-(7ci)?
The molecular formula is C10H8Cl2N2O.
When was Benzimidazole, 1-(dichloroacetyl)-2-methyl-(7ci) created and last modified?
It was created on September 15, 2005, and last modified on December 30, 2023.
What is the IUPAC name of Benzimidazole, 1-(dichloroacetyl)-2-methyl-(7ci)?
The IUPAC name is 2,2-dichloro-1-(2-methylbenzimidazol-1-yl)ethanone.
What is the InChIKey of Benzimidazole, 1-(dichloroacetyl)-2-methyl-(7ci)?
The InChIKey is LWLUBBBLZLKJCA-UHFFFAOYSA-N.
What is the Canonical SMILES representation of Benzimidazole, 1-(dichloroacetyl)-2-methyl-(7ci)?
The Canonical SMILES representation is CC1=NC2=CC=CC=C2N1C(=O)C(Cl)Cl.
What is the molecular weight of Benzimidazole, 1-(dichloroacetyl)-2-methyl-(7ci)?
The molecular weight is 243.09 g/mol.
What is the XLogP3-AA value of Benzimidazole, 1-(dichloroacetyl)-2-methyl-(7ci)?
The XLogP3-AA value is 3.1.
How many hydrogen bond donor counts does Benzimidazole, 1-(dichloroacetyl)-2-methyl-(7ci) have?
It has 0 hydrogen bond donor counts.
What is the exact mass of Benzimidazole, 1-(dichloroacetyl)-2-methyl-(7ci)?
The exact mass is 242.0013683 g/mol.
Is the compound canonicalized for Benzimidazole, 1-(dichloroacetyl)-2-methyl-(7ci)?
Yes, the compound is canonicalized.