What is the molecular formula of 2(1H)-quinoxalinone, 3,4-dihydro-6-(4-methyl-1-piperazinyl)?
The molecular formula is C13H18N4O.
What is the molecular weight of 2(1H)-quinoxalinone, 3,4-dihydro-6-(4-methyl-1-piperazinyl)?
The molecular weight is 246.31 g/mol.
When was 2(1H)-quinoxalinone, 3,4-dihydro-6-(4-methyl-1-piperazinyl) created and last modified in PubChem?
It was created on 2005-03-26 and last modified on 2023-12-30.
What is the IUPAC name of 2(1H)-quinoxalinone, 3,4-dihydro-6-(4-methyl-1-piperazinyl)?
The IUPAC name is 6-(4-methylpiperazin-1-yl)-3,4-dihydro-1H-quinoxalin-2-one.
What is the InChIKey of 2(1H)-quinoxalinone, 3,4-dihydro-6-(4-methyl-1-piperazinyl)?
The InChIKey is JVHHLGJKLYTZAV-UHFFFAOYSA-N.
What is the canonical SMILES notation for 2(1H)-quinoxalinone, 3,4-dihydro-6-(4-methyl-1-piperazinyl)?
The canonical SMILES notation is CN1CCN(CC1)C2=CC3=C(C=C2)NC(=O)CN3.
How many hydrogen bond donor counts are there in 2(1H)-quinoxalinone, 3,4-dihydro-6-(4-methyl-1-piperazinyl)?
There are 2 hydrogen bond donor counts.
What is the XLogP3-AA value for 2(1H)-quinoxalinone, 3,4-dihydro-6-(4-methyl-1-piperazinyl)?
The XLogP3-AA value is 0.8.
What is the topological polar surface area of 2(1H)-quinoxalinone, 3,4-dihydro-6-(4-methyl-1-piperazinyl)?
The topological polar surface area is 47.6 Å2.
Is 2(1H)-quinoxalinone, 3,4-dihydro-6-(4-methyl-1-piperazinyl) a canonicalized compound?
Yes, it is a canonicalized compound according to PubChem.