What is the molecular formula of Uridine diphosphate galactose?
The molecular formula of Uridine diphosphate galactose is C15H24N2O17P2.
What is the molecular weight of Uridine diphosphate galactose?
The molecular weight of Uridine diphosphate galactose is 570.32 g/mol.
When was Uridine diphosphate galactose created?
Uridine diphosphate galactose was created on February 16, 2015.
When was Uridine diphosphate galactose last modified?
Uridine diphosphate galactose was last modified on December 30, 2023.
What is the IUPAC Name of Uridine diphosphate galactose?
The IUPAC Name of Uridine diphosphate galactose is [[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[hydroxy(ditritio)methyl]oxan-2-yl] hydrogen phosphate.
What is the InChI of Uridine diphosphate galactose?
The InChI of Uridine diphosphate galactose is InChI=1S/C15H24N2O17P2/c18-3-5-8(20)10(22)12(24)14(32-5)33-36(28,29)34-35(26,27)30-4-6-9(21)11(23)13(31-6)17-2-1-7(19)16-15(17)25/h1-2,5-6,8-14,18,20-24H,3-4H2,(H,26,27)(H,28,29)(H,16,19,25)/t5-,6-,8+,9-,10+,11-,12-,13-,14-/m1/s1/i3T2.
What is the InChIKey of Uridine diphosphate galactose?
The InChIKey of Uridine diphosphate galactose is HSCJRCZFDFQWRP-SWBLRQLRSA-N.
What is the Canonical SMILES of Uridine diphosphate galactose?
The Canonical SMILES of Uridine diphosphate galactose is C1=CN(C(=O)NC1=O)C2C(C(C(O2)COP(=O)(O)OP(=O)(O)OC3C(C(C(C(O3)CO)O)O)O)O)O.
What is the XLogP3 value of Uridine diphosphate galactose?
The XLogP3 value of Uridine diphosphate galactose is -6.3.
How many hydrogen bond donor counts are there in Uridine diphosphate galactose?
There are 9 hydrogen bond donor counts in Uridine diphosphate galactose.