What is the molecular formula of Indisocin?
The molecular formula of Indisocin is C13H9ClN2O3.
What are the synonyms of Indisocin?
The synonyms of Indisocin are Indisocin 90632-49-8, [3-[(Z)-2-chloro-2-isocyanoethenyl]-2-oxo-1H-indol-3-yl] acetate, 1,3-Dihydro-3-(acetyloxy)-3-(2-chloro-2-isocyanoethenyl)-2H-indol-2-one (E)-(+)-, and 2H-Indol-2-one, 1,3-dihydro-3-(acetyloxy)-3-(2-chloro-2-isocyanoethenyl)-, (E)-(+)-.
What is the molecular weight of Indisocin?
The molecular weight of Indisocin is 276.67 g/mol.
What is the IUPAC name of Indisocin?
The IUPAC name of Indisocin is [3-[(Z)-2-chloro-2-isocyanoethenyl]-2-oxo-1H-indol-3-yl] acetate.
What is the InChI of Indisocin?
The InChI of Indisocin is InChI=1S/C13H9ClN2O3/c1-8(17)19-13(7-11(14)15-2)9-5-3-4-6-10(9)16-12(13)18/h3-7H,1H3,(H,16,18)/b11-7+.
What is the InChIKey of Indisocin?
The InChIKey of Indisocin is NFAZQDQNOPUWCO-YRNVUSSQSA-N.
What is the Canonical SMILES of Indisocin?
The Canonical SMILES of Indisocin is CC(=O)OC1(C2=CC=CC=C2NC1=O)C=C([N+]#[C-])Cl.
What is the isomeric SMILES of Indisocin?
The isomeric SMILES of Indisocin is CC(=O)OC1(C2=CC=CC=C2NC1=O)/C=C(/[N+]#[C-])\Cl.
What is the CAS number of Indisocin?
The CAS number of Indisocin is 90632-49-8.
Is Indisocin a canonicalized compound?
Yes, Indisocin is a canonicalized compound.