What is the molecular formula of O-Benzyl-L-threonine?
The molecular formula of O-Benzyl-L-threonine is C11H15NO3.
What is the molecular weight of O-Benzyl-L-threonine?
The molecular weight of O-Benzyl-L-threonine is 209.24 g/mol.
When was O-Benzyl-L-threonine created?
O-Benzyl-L-threonine was created on July 28, 2006.
When was O-Benzyl-L-threonine last modified?
O-Benzyl-L-threonine was last modified on December 30, 2023.
What is the IUPAC name of O-Benzyl-L-threonine?
The IUPAC name of O-Benzyl-L-threonine is (2S,3R)-2-amino-3-phenylmethoxybutanoic acid.
What is the InChI of O-Benzyl-L-threonine?
The InChI of O-Benzyl-L-threonine is InChI=1S/C11H15NO3/c1-8(10(12)11(13)14)15-7-9-5-3-2-4-6-9/h2-6,8,10H,7,12H2,1H3,(H,13,14)/t8-,10+/m1/s1.
What is the InChIKey of O-Benzyl-L-threonine?
The InChIKey of O-Benzyl-L-threonine is ONOURAAVVKGJNM-SCZZXKLOSA-N.
What is the canonical SMILES of O-Benzyl-L-threonine?
The canonical SMILES of O-Benzyl-L-threonine is CC(C(C(=O)O)N)OCC1=CC=CC=C1.
What is the CAS number of O-Benzyl-L-threonine?
The CAS number of O-Benzyl-L-threonine is 4378-10-3.