What is the molecular formula of 2,3-Dihydro-4-(trifluoromethyl)-1H-indole?
The molecular formula is C9H8F3N.
What is the molecular weight of 2,3-Dihydro-4-(trifluoromethyl)-1H-indole?
The molecular weight is 187.16 g/mol.
What is the IUPAC name of 2,3-Dihydro-4-(trifluoromethyl)-1H-indole?
The IUPAC name is 4-(trifluoromethyl)-2,3-dihydro-1H-indole.
What is the InChI of 2,3-Dihydro-4-(trifluoromethyl)-1H-indole?
The InChI is InChI=1S/C9H8F3N/c10-9(11,12)7-2-1-3-8-6(7)4-5-13-8/h1-3,13H,4-5H2.
What is the InChIKey of 2,3-Dihydro-4-(trifluoromethyl)-1H-indole?
The InChIKey is FOCIDGZBJANSEG-UHFFFAOYSA-N.
What is the Canonical SMILES of 2,3-Dihydro-4-(trifluoromethyl)-1H-indole?
The Canonical SMILES is C1CNC2=CC=CC(=C21)C(F)(F)F.
What is the CAS number of 2,3-Dihydro-4-(trifluoromethyl)-1H-indole?
The CAS number is 905274-07-9.
How many hydrogen bond donor counts are there in 2,3-Dihydro-4-(trifluoromethyl)-1H-indole?
There is 1 hydrogen bond donor count.
What is the topological polar surface area of 2,3-Dihydro-4-(trifluoromethyl)-1H-indole?
The topological polar surface area is 12.2.
Is the compound canonicalized?
Yes, the compound is canonicalized.