What is the molecular formula of 3-Bromo-2-phenyl-imidazo[1,2-a]pyrimidine?
The molecular formula is C12H8BrN3.
What is the molecular weight of 3-Bromo-2-phenyl-imidazo[1,2-a]pyrimidine?
The molecular weight is 274.12 g/mol.
What is the IUPAC name of 3-Bromo-2-phenyl-imidazo[1,2-a]pyrimidine?
The IUPAC name is 3-bromo-2-phenylimidazo[1,2-a]pyrimidine.
What is the InChI of 3-Bromo-2-phenyl-imidazo[1,2-a]pyrimidine?
The InChI is InChI=1S/C12H8BrN3/c13-11-10(9-5-2-1-3-6-9)15-12-14-7-4-8-16(11)12/h1-8H.
What is the InChIKey of 3-Bromo-2-phenyl-imidazo[1,2-a]pyrimidine?
The InChIKey is ADGMBHUSGZGHTE-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Bromo-2-phenyl-imidazo[1,2-a]pyrimidine?
The canonical SMILES is C1=CC=C(C=C1)C2=C(N3C=CC=NC3=N2)Br.
What is the XLogP3-AA value of 3-Bromo-2-phenyl-imidazo[1,2-a]pyrimidine?
The XLogP3-AA value is 3.8.
How many hydrogen bond donor counts does 3-Bromo-2-phenyl-imidazo[1,2-a]pyrimidine have?
It has 0 hydrogen bond donor counts.
What is the topological polar surface area of 3-Bromo-2-phenyl-imidazo[1,2-a]pyrimidine?
The topological polar surface area is 30.2 Å2.
Is 3-Bromo-2-phenyl-imidazo[1,2-a]pyrimidine a canonicalized compound according to PubChem?
Yes, it is a canonicalized compound.