What is the molecular formula of the proteasome substrate vi, fluorogenic?
The molecular formula is C33H44N10O7.
When was the proteasome substrate vi, fluorogenic created and modified in PubChem?
It was created on 2008-12-29 and modified on 2023-12-30.
What is the IUPAC Name of the proteasome substrate vi, fluorogenic?
The IUPAC Name is benzyl N-[(2S)-1-[[(2S)-5-(diaminomethylideneamino)-1-[[(2S)-5-(diaminomethylideneamino)-1-[(4-methyl-2-oxochromen-7-yl)amino]-1-oxopentan-2-yl]amino]-1-oxopentan-2-yl]amino]-1-oxopropan-2-yl]carbamate.
What is the InChIKey of the proteasome substrate vi, fluorogenic?
The InChIKey is RACPARIFVUIBCA-OPXMRZJTSA-N.
What is the Canonical SMILES of the proteasome substrate vi, fluorogenic?
The Canonical SMILES is CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)C(CCCN=C(N)N)NC(=O)C(CCCN=C(N)N)NC(=O)C(C)NC(=O)OCC3=CC=CC=C3.
What is the molecular weight of the proteasome substrate vi, fluorogenic?
The molecular weight is 692.8 g/mol.
How many hydrogen bond donor counts does the proteasome substrate vi, fluorogenic have?
It has 8 hydrogen bond donor counts.
How many heavy atom counts does the proteasome substrate vi, fluorogenic have?
It has 50 heavy atom counts.
What is the XLogP3-AA value of the proteasome substrate vi, fluorogenic?
The XLogP3-AA value is -0.3.
What is the topological polar surface area of the proteasome substrate vi, fluorogenic?
The topological polar surface area is 281 Å2.
※ Please kindly note that our products are for research use only.
Download
![2-Isopropyl-[1,3]oxathiepane](https://resource.alfa-chemistry.com/structure/90467-75-7.gif)
