9042-14-2 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C19H16O2.
The compound was created in PubChem on 2005-03-26.
The IUPAC name of the compound is 2-(1-naphthalen-2-ylethyl)benzoic acid.
The InChIKey of the compound is VGPUVBCHZSXLPG-UHFFFAOYSA-N.
The Canonical SMILES of the compound is CC(C1=CC2=CC=CC=C2C=C1)C3=CC=CC=C3C(=O)O.
The molecular weight of the compound is 276.3 g/mol.
The compound has 1 hydrogen bond donor count.
The compound has 2 hydrogen bond acceptor counts.
The exact mass of the compound is 276.115029749 g/mol.
Yes, the compound is canonicalized according to PubChem.