What is the molecular formula of 3-ISOTHIAZOL-5-YLPHENOL?
The molecular formula of 3-ISOTHIAZOL-5-YLPHENOL is C9H7NOS.
What is the molecular weight of 3-ISOTHIAZOL-5-YLPHENOL?
The molecular weight of 3-ISOTHIAZOL-5-YLPHENOL is 177.22 g/mol.
What is the IUPAC name of 3-ISOTHIAZOL-5-YLPHENOL?
The IUPAC name of 3-ISOTHIAZOL-5-YLPHENOL is 3-(1,2-thiazol-5-yl)phenol.
What is the InChI of 3-ISOTHIAZOL-5-YLPHENOL?
The InChI of 3-ISOTHIAZOL-5-YLPHENOL is InChI=1S/C9H7NOS/c11-8-3-1-2-7(6-8)9-4-5-10-12-9/h1-6,11H.
What is the InChIKey of 3-ISOTHIAZOL-5-YLPHENOL?
The InChIKey of 3-ISOTHIAZOL-5-YLPHENOL is FCDPMAHEIXHRCH-UHFFFAOYSA-N.
What is the canonical SMILES of 3-ISOTHIAZOL-5-YLPHENOL?
The canonical SMILES of 3-ISOTHIAZOL-5-YLPHENOL is C1=CC(=CC(=C1)O)C2=CC=NS2.
What is the CAS number of 3-ISOTHIAZOL-5-YLPHENOL?
The CAS number of 3-ISOTHIAZOL-5-YLPHENOL is 904085-96-7.
What is the XLogP3-AA value of 3-ISOTHIAZOL-5-YLPHENOL?
The XLogP3-AA value of 3-ISOTHIAZOL-5-YLPHENOL is 2.3.
Is 3-ISOTHIAZOL-5-YLPHENOL considered a canonicalized compound?
Yes, 3-ISOTHIAZOL-5-YLPHENOL is considered a canonicalized compound according to PubChem.