CAS
9037-88-1 Purity
---
9037-88-1 Purity
---
Shopping basket
1,4-Dioxin-2-carboxamide,N-(3-acetylphenyl)-5,6-dihydro-
CAS
903800-25-9
Catalog Number
ACM903800259
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C13H13NO4.
What is the molecular weight of the compound?
The molecular weight of the compound is 247.25 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is N-(3-acetylphenyl)-2,3-dihydro-1,4-dioxine-5-carboxamide.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C13H13NO4/c1-9(15)10-3-2-4-11(7-10)14-13(16)12-8-17-5-6-18-12/h2-4,7-8H,5-6H2,1H3,(H,14,16).
What is the InChIKey of the compound?
The InChIKey of the compound is PZSGLEPUXYIFOJ-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CC(=O)C1=CC(=CC=C1)NC(=O)C2=COCCO2.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 0.9.
How many hydrogen bond donor counts does the compound have?
The compound has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does the compound have?
The compound has 4 hydrogen bond acceptor counts.
How many rotatable bond counts does the compound have?
The compound has 3 rotatable bond counts.
Recommended Products
CAS
90378-85-1 Purity
96%
90378-85-1 Purity
96%
