What is the molecular formula of 8-Nitro-4-Chromanone?
The molecular formula of 8-Nitro-4-Chromanone is C9H7NO4.
What are some synonyms for 8-Nitro-4-Chromanone?
Some synonyms for 8-Nitro-4-Chromanone include 8-Nitrochroman-4-one and 8-nitro-2,3-dihydrochromen-4-one.
When was 8-Nitro-4-Chromanone created and modified in PubChem?
8-Nitro-4-Chromanone was created on 2007-12-04 and modified on 2023-12-30 in PubChem.
What is the IUPAC name of 8-Nitro-4-Chromanone?
The IUPAC name of 8-Nitro-4-Chromanone is 8-nitro-2,3-dihydrochromen-4-one.
What is the InChI of 8-Nitro-4-Chromanone?
The InChI of 8-Nitro-4-Chromanone is InChI=1S/C9H7NO4/c11-8-4-5-14-9-6(8)2-1-3-7(9)10(12)13/h1-3H,4-5H2.
What is the Canonical SMILES of 8-Nitro-4-Chromanone?
The Canonical SMILES of 8-Nitro-4-Chromanone is C1COC2=C(C1=O)C=CC=C2[N+](=O)[O-].
What is the molecular weight of 8-Nitro-4-Chromanone?
The molecular weight of 8-Nitro-4-Chromanone is 193.16 g/mol.
How many hydrogen bond acceptor counts does 8-Nitro-4-Chromanone have?
8-Nitro-4-Chromanone has 4 hydrogen bond acceptor counts.
What is the exact mass of 8-Nitro-4-Chromanone?
The exact mass of 8-Nitro-4-Chromanone is 193.03750770 g/mol.
Is 8-Nitro-4-Chromanone a canonicalized compound according to PubChem?
Yes, 8-Nitro-4-Chromanone is a canonicalized compound according to PubChem.