What is the PubChem CID of 4-Bromo-N-methylphthalimide?
PubChem CID 790105.
What is the molecular formula of 4-Bromo-N-methylphthalimide?
The molecular formula is C9H6BrNO2.
What are the synonyms for 4-Bromo-N-methylphthalimide?
The synonyms include 90224-73-0, 5-Bromo-2-methylisoindoline-1,3-dione, 5-bromo-2-methylisoindole-1,3-dione, 5-bromo-2-methyl-1h-isoindole-1,3(2h)-dione.
What is the molecular weight of 4-Bromo-N-methylphthalimide?
The molecular weight is 240.05 g/mol.
What is the IUPAC name of 4-Bromo-N-methylphthalimide?
The IUPAC name is 5-bromo-2-methylisoindole-1,3-dione.
What is the InChI of 4-Bromo-N-methylphthalimide?
The InChI is InChI=1S/C9H6BrNO2/c1-11-8(12)6-3-2-5(10)4-7(6)9(11)13/h2-4H,1H3.
What is the InChIKey of 4-Bromo-N-methylphthalimide?
The InChIKey is BEIQHTQYTDPHLX-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Bromo-N-methylphthalimide?
The canonical SMILES is CN1C(=O)C2=C(C1=O)C=C(C=C2)Br.
What is the CAS number of 4-Bromo-N-methylphthalimide?
The CAS number is 90224-73-0.
What is the European Community (EC) number of 4-Bromo-N-methylphthalimide?
The EC number is 679-566-1.
※ Please kindly note that our products are for research use only.