What is the molecular formula of Chembrdg-bb 7122570?
The molecular formula of Chembrdg-bb 7122570 is C13H14O3.
What is the molecular weight of Chembrdg-bb 7122570?
The molecular weight of Chembrdg-bb 7122570 is 218.25 g/mol.
When was Chembrdg-bb 7122570 created?
Chembrdg-bb 7122570 was created on July 30, 2006.
When was Chembrdg-bb 7122570 last modified?
Chembrdg-bb 7122570 was last modified on December 30, 2023.
What is the IUPAC name of Chembrdg-bb 7122570?
The IUPAC name of Chembrdg-bb 7122570 is 2-(4,6,7-trimethyl-1-benzofuran-3-yl)acetic acid.
What is the InChI of Chembrdg-bb 7122570?
The InChI of Chembrdg-bb 7122570 is InChI=1S/C13H14O3/c1-7-4-8(2)12-10(5-11(14)15)6-16-13(12)9(7)3/h4,6H,5H2,1-3H3,(H,14,15).
What is the InChIKey of Chembrdg-bb 7122570?
The InChIKey of Chembrdg-bb 7122570 is CUFRNCSINASUIQ-UHFFFAOYSA-N.
What is the canonical SMILES of Chembrdg-bb 7122570?
The canonical SMILES of Chembrdg-bb 7122570 is CC1=CC(=C2C(=COC2=C1C)CC(=O)O).
What is the CAS number of Chembrdg-bb 7122570?
The CAS number of Chembrdg-bb 7122570 is 902139-76-8.
What is the XLogP3-AA value of Chembrdg-bb 7122570?
The XLogP3-AA value of Chembrdg-bb 7122570 is 2.9.