What is the molecular formula of Cyclobutanecarboxamide, 3-acetyl-2,2-dimethyl- (9CI)?
The molecular formula is C9H15NO2.
What is the molecular weight of Cyclobutanecarboxamide, 3-acetyl-2,2-dimethyl- (9CI)?
The molecular weight is 169.22 g/mol.
What is the IUPAC name of Cyclobutanecarboxamide, 3-acetyl-2,2-dimethyl- (9CI)?
The IUPAC name is 3-acetyl-2,2-dimethylcyclobutane-1-carboxamide.
What is the InChI of Cyclobutanecarboxamide, 3-acetyl-2,2-dimethyl- (9CI)?
The InChI is InChI=1S/C9H15NO2/c1-5(11)6-4-7(8(10)12)9(6,2)3/h6-7H,4H2,1-3H3,(H2,10,12).
What is the InChIKey of Cyclobutanecarboxamide, 3-acetyl-2,2-dimethyl- (9CI)?
The InChIKey is WWSTXACPMROKQA-UHFFFAOYSA-N.
What is the Canonical SMILES of Cyclobutanecarboxamide, 3-acetyl-2,2-dimethyl- (9CI)?
The Canonical SMILES is CC(=O)C1CC(C1(C)C)C(=O)N.
How many hydrogen bond donor counts does Cyclobutanecarboxamide, 3-acetyl-2,2-dimethyl- (9CI) have?
It has 1 hydrogen bond donor count.
What is the topological polar surface area of Cyclobutanecarboxamide, 3-acetyl-2,2-dimethyl- (9CI)?
The topological polar surface area is 60.2 Ų.
Is Cyclobutanecarboxamide, 3-acetyl-2,2-dimethyl- (9CI) a canonicalized compound?
Yes, it is a canonicalized compound.
How many rotatable bond counts does Cyclobutanecarboxamide, 3-acetyl-2,2-dimethyl- (9CI) have?
It has 2 rotatable bond counts.