What is the molecular formula of colanic acid?
The molecular formula of colanic acid is C24H40O2.
What is the molecular weight of colanic acid?
The molecular weight of colanic acid is 360.6 g/mol.
When was colanic acid created and modified?
Colanic acid was created on October 4, 2006, and modified on December 30, 2023.
What is the IUPAC name of colanic acid?
The IUPAC name of colanic acid is (4R)-4-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid.
What is the InChIKey of colanic acid?
The InChIKey of colanic acid is RPKLZQLYODPWTM-KBMWBBLPSA-N.
What is the canonical SMILES of colanic acid?
The canonical SMILES of colanic acid is CC(CCC(=O)O)C1CCC2C1(CCC3C2CCC4C3(CCCC4)C).
What is the CAS number of colanic acid?
The CAS number of colanic acid is 25312-65-6.
What is the European Community (EC) number of colanic acid?
The European Community (EC) number of colanic acid is 246-816-2.
What is the UNII of colanic acid?
The UNII of colanic acid is NS0L7RS7DA.
What is the XLogP3-AA value of colanic acid?
The XLogP3-AA value of colanic acid is 8.