What is the molecular formula of beta-D-glucose?
The molecular formula of beta-D-glucose is C6H12O6.
What is the molecular weight of beta-D-glucose?
The molecular weight of beta-D-glucose is 180.16 g/mol.
What is the IUPAC name of beta-D-glucose?
The IUPAC name of beta-D-glucose is (2R,3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol.
What is the InChI of beta-D-glucose?
The InChI of beta-D-glucose is InChI=1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4+,5-,6-/m1/s1.
What is the InChIKey of beta-D-glucose?
The InChIKey of beta-D-glucose is WQZGKKKJIJFFOK-VFUOTHLCSA-N.
What is the canonical SMILES of beta-D-glucose?
The canonical SMILES of beta-D-glucose is C(C1C(C(C(C(O1)O)O)O)O)O.
What is the isomeric SMILES of beta-D-glucose?
The isomeric SMILES of beta-D-glucose is C([C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O)O)O)O)O.
What is the CAS number of beta-D-glucose?
The CAS number of beta-D-glucose is 492-61-5.
What is the ChEBI ID of beta-D-glucose?
The ChEBI ID of beta-D-glucose is not mentioned in the reference.
What is the primary source of energy for living organisms?
Glucose is the primary source of energy for living organisms.