90090-64-5 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C15H11F6NO3S.
The synonyms for the compound are CHEMBL483134, AKOS003978886, Z45657421, and N-(3,5-bis-(Trifluoromethyl)phenyl)-4-methoxybenzenesulfonamide.
The molecular weight of the compound is 399.3 g/mol.
The IUPAC name of the compound is N-[3,5-bis(trifluoromethyl)phenyl]-4-methoxybenzenesulfonamide.
The InChI key of the compound is MSMRTTSGIOPDGI-UHFFFAOYSA-N.
The canonical SMILES representation of the compound is COC1=CC=C(C=C1)S(=O)(=O)NC2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F.
The XLogP3 value of the compound is 4.
There are 10 hydrogen bond acceptors in the compound.
The topological polar surface area of the compound is 63.8 Ų.
Yes, the compound is canonicalized.