What is the molecular formula of 2-Butenedial,2-hydroxy?
The molecular formula is C4H4O3.
What is the molecular weight of 2-Butenedial,2-hydroxy?
The molecular weight is 100.07 g/mol.
What is the IUPAC name of 2-Butenedial,2-hydroxy?
The IUPAC name is (Z)-4-hydroxy-2-oxobut-3-enal.
What is the InChI of 2-Butenedial,2-hydroxy?
The InChI is InChI=1S/C4H4O3/c5-2-1-4(7)3-6/h1-3,5H/b2-1-.
What is the InChIKey of 2-Butenedial,2-hydroxy?
The InChIKey is ZLWNFOVEHWUAJI-UPHRSURJSA-N.
What is the canonical SMILES of 2-Butenedial,2-hydroxy?
The canonical SMILES is C(=CO)C(=O)C=O.
What is the isomeric SMILES of 2-Butenedial,2-hydroxy?
The isomeric SMILES is C(=C\O)\C(=O)C=O.
What is the CAS number of 2-Butenedial,2-hydroxy?
The CAS number is 90065-65-9.
What is the hydrogen bond donor count of 2-Butenedial,2-hydroxy?
The hydrogen bond donor count is 1.
What is the hydrogen bond acceptor count of 2-Butenedial,2-hydroxy?
The hydrogen bond acceptor count is 3.