What is the molecular formula of 1-(4-Chloro-3-nitrophenyl)-cyclopropanamine?
The molecular formula is C9H9ClN2O2.
What are the synonyms of 1-(4-Chloro-3-nitrophenyl)-cyclopropanamine?
The synonyms are 900505-08-0, Cyclopropanamine, 1-(4-chloro-3-nitrophenyl)-, 1-(4-Chloro-3-nitrophenyl)-cyclopropanamine, EN300-1981583, 1-(4-CHLORO-3-NITROPHENYL)CYCLOPROPAN-1-AMINE.
What is the molecular weight of 1-(4-Chloro-3-nitrophenyl)-cyclopropanamine?
The molecular weight is 212.63 g/mol.
When was 1-(4-Chloro-3-nitrophenyl)-cyclopropanamine created?
It was created on March 7, 2014.
When was 1-(4-Chloro-3-nitrophenyl)-cyclopropanamine last modified?
It was last modified on December 30, 2023.
What is the IUPAC name of 1-(4-Chloro-3-nitrophenyl)-cyclopropanamine?
The IUPAC name is 1-(4-chloro-3-nitrophenyl)cyclopropan-1-amine.
What is the InChI of 1-(4-Chloro-3-nitrophenyl)-cyclopropanamine?
The InChI is InChI=1S/C9H9ClN2O2/c10-7-2-1-6(9(11)3-4-9)5-8(7)12(13)14/h1-2,5H,3-4,11H2.
What is the InChIKey of 1-(4-Chloro-3-nitrophenyl)-cyclopropanamine?
The InChIKey is GKDYGZDTYBFEGW-UHFFFAOYSA-N.
What is the Canonical SMILES of 1-(4-Chloro-3-nitrophenyl)-cyclopropanamine?
The Canonical SMILES is C1CC1(C2=CC(=C(C=C2)Cl)[N+](=O)[O-])N.
What is the XLogP3-AA value of 1-(4-Chloro-3-nitrophenyl)-cyclopropanamine?
The XLogP3-AA value is 1.6.
※ Please kindly note that our products are for research use only.